4-methylumbelliferyl phosphate, bis(2-amino-2-methyl-1,3-propanediol) salt structure
|
Common Name | 4-methylumbelliferyl phosphate, bis(2-amino-2-methyl-1,3-propanediol) salt | ||
|---|---|---|---|---|
| CAS Number | 107475-10-5 | Molecular Weight | 466.42000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H31N2O10P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 4-methylumbelliferyl phosphate, bis(2-amino-2-methyl-1,3-propanediol) salt4-Methylumbelliferyl phosphate (2-amino-2-methyl-1,3-propanediol) is a fluorescent substrate, can be used as substrate buffer of enzyme assay[1]. |
| Name | 4-methylumbelliferyl phosphate, bis(2-amino-2-methyl-1,3-propanediol) salt |
|---|---|
| Synonym | More Synonyms |
| Description | 4-Methylumbelliferyl phosphate (2-amino-2-methyl-1,3-propanediol) is a fluorescent substrate, can be used as substrate buffer of enzyme assay[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C18H31N2O10P |
|---|---|
| Molecular Weight | 466.42000 |
| Exact Mass | 466.17200 |
| PSA | 239.74000 |
| LogP | 0.35030 |
| InChIKey | BFRZFPYLAVZIPA-UHFFFAOYSA-N |
| SMILES | CC(N)(CO)CO.CC(N)(CO)CO.Cc1cc(=O)oc2cc(OP(=O)(O)O)ccc12 |
| mup 2 ampd |