4-(3-Chloro-2-methoxyphenyl)benzoic acid structure
|
Common Name | 4-(3-Chloro-2-methoxyphenyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 107517-12-4 | Molecular Weight | 262.68800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H11ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(3-Chloro-2-methoxyphenyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H11ClO3 |
|---|---|
| Molecular Weight | 262.68800 |
| Exact Mass | 262.04000 |
| PSA | 46.53000 |
| LogP | 3.71380 |
| InChIKey | OZEGOURKMWFSPI-UHFFFAOYSA-N |
| SMILES | COc1c(Cl)cccc1-c1ccc(C(=O)O)cc1 |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-Biphenylcarboxylicacid,3'-chloro-2'-methoxy-(6CI) |
| 3'-Chlor-2'-methoxy-biphenyl-4-carbonsaeure |
| 3'-chloro-2'-methoxy-biphenyl-4-carboxylic acid |
| [1,1'-Biphenyl]-4-carboxylicacid,3'-chloro-2'-methoxy |