5-Chloro-1-phenyl-3-(trifluoromethyl)-1H-pyrazole structure
|
Common Name | 5-Chloro-1-phenyl-3-(trifluoromethyl)-1H-pyrazole | ||
|---|---|---|---|---|
| CAS Number | 1076197-51-7 | Molecular Weight | 246.616 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 271.2±35.0 °C at 760 mmHg | |
| Molecular Formula | C10H6ClF3N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 117.8±25.9 °C | |
| Name | 5-chloro-1-phenyl-3-(trifluoromethyl)pyrazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 271.2±35.0 °C at 760 mmHg |
| Molecular Formula | C10H6ClF3N2 |
| Molecular Weight | 246.616 |
| Flash Point | 117.8±25.9 °C |
| Exact Mass | 246.017166 |
| PSA | 17.82000 |
| LogP | 4.18 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.543 |
| InChIKey | DSBJWIFNTPHCSS-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1cc(Cl)n(-c2ccccc2)n1 |
|
~71%
5-Chloro-1-phen... CAS#:1076197-51-7 |
| Literature: Bozhenkov; Savosik; Larina; Klyba; Zhanchipova; Mirskova; Levkovskaya Russian Journal of Organic Chemistry, 2008 , vol. 44, # 7 p. 1014 - 1023 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 5-CHLORO-1-PHENYL-3-TRIFLUOROMETHYL-1H-PYRAZOLE |
| 5-Chloro-1-phenyl-3-(trifluoromethyl)-1H-pyrazole |
| 3-trifluoromethyl-1-phenyl-5-chloropyrazole |
| 1H-Pyrazole, 5-chloro-1-phenyl-3-(trifluoromethyl)- |