4-benzylsulfonyl-2-chlorophenol structure
|
Common Name | 4-benzylsulfonyl-2-chlorophenol | ||
|---|---|---|---|---|
| CAS Number | 107624-69-1 | Molecular Weight | 282.74300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H11ClO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-benzylsulfonyl-2-chlorophenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H11ClO3S |
|---|---|
| Molecular Weight | 282.74300 |
| Exact Mass | 282.01200 |
| PSA | 62.75000 |
| LogP | 4.10030 |
| InChIKey | XTOZMQSSMGXVFR-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cc1ccccc1)c1ccc(O)c(Cl)c1 |
|
~%
4-benzylsulfony... CAS#:107624-69-1 |
| Literature: Hartman et al. Journal of the Karnatak University, 1958 , vol. 3, p. 38,51 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-Chlor-4-phenylmethansulfonyl-phenol |
| 2-chloro-4-phenylmethanesulfonyl-phenol |