2-methyl-5-phenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one structure
|
Common Name | 2-methyl-5-phenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one | ||
|---|---|---|---|---|
| CAS Number | 107625-17-2 | Molecular Weight | 225.24600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H11N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methyl-5-phenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one |
|---|
| Molecular Formula | C13H11N3O |
|---|---|
| Molecular Weight | 225.24600 |
| Exact Mass | 225.09000 |
| PSA | 50.16000 |
| LogP | 1.99800 |
| InChIKey | HHROHNILKCJWQG-UHFFFAOYSA-N |
| SMILES | Cc1cc2nc(-c3ccccc3)cc(=O)n2[nH]1 |
|
~%
2-methyl-5-phen... CAS#:107625-17-2 |
| Literature: US2006/135526 A1, ; Page/Page column 12-13 ; US 20060135526 A1 |
|
~%
2-methyl-5-phen... CAS#:107625-17-2 |
| Literature: Journal of Organic Chemistry, , vol. 24, p. 787,792 |
|
~65%
2-methyl-5-phen... CAS#:107625-17-2 |
| Literature: Chemistry of Heterocyclic Compounds, , vol. 39, # 9 p. 1210 - 1212 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |