(4S,5R)-4-(4-chlorophenyl)-5-propan-2-yl-4-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-2-one
Modify Date: 2025-08-24 17:23:31
(4S,5R)-4-(4-chlorophenyl)-5-propan-2-yl-4-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-2-one structure
|
Common Name | (4S,5R)-4-(4-chlorophenyl)-5-propan-2-yl-4-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-2-one | ||
|---|---|---|---|---|
| CAS Number | 107659-83-6 | Molecular Weight | 321.75900 | |
| Density | 1.38g/cm3 | Boiling Point | 530.8ºC at 760 mmHg | |
| Molecular Formula | C15H16ClN3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 274.8ºC | |
| Name | (4S,5R)-4-(4-chlorophenyl)-5-propan-2-yl-4-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-2-one |
|---|
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 530.8ºC at 760 mmHg |
| Molecular Formula | C15H16ClN3O3 |
| Molecular Weight | 321.75900 |
| Flash Point | 274.8ºC |
| Exact Mass | 321.08800 |
| PSA | 66.24000 |
| LogP | 3.01840 |
| Vapour Pressure | 2.39E-11mmHg at 25°C |
| Index of Refraction | 1.629 |
| InChIKey | CUSPALNPQMWUGZ-UKRRQHHQSA-N |
| SMILES | CC(C)C1OC(=O)OC1(Cn1cncn1)c1ccc(Cl)cc1 |
|
~52%
(4S,5R)-4-(4-ch... CAS#:107659-83-6 |
| Literature: Ogata; Matsumoto; Takahashi; Shimizu; Kida; Murabayashi; Shiro; Tawara Journal of Medicinal Chemistry, 1987 , vol. 30, # 6 p. 1054 - 1068 |
|
~%
(4S,5R)-4-(4-ch... CAS#:107659-83-6 |
| Literature: Ogata; Matsumoto; Takahashi; Shimizu; Kida; Murabayashi; Shiro; Tawara Journal of Medicinal Chemistry, 1987 , vol. 30, # 6 p. 1054 - 1068 |
|
~%
(4S,5R)-4-(4-ch... CAS#:107659-83-6 |
| Literature: Ogata; Matsumoto; Takahashi; Shimizu; Kida; Murabayashi; Shiro; Tawara Journal of Medicinal Chemistry, 1987 , vol. 30, # 6 p. 1054 - 1068 |
![5-amino-4-cyano-2,3-dihydro-1H-benz[e]indene structure](https://image.chemsrc.com/caspic/064/65248-53-5.png)
| Precursor 3 | |
|---|---|
| DownStream 0 | |