(2R,3R)-2-(4-chlorophenyl)-3-(4-fluorophenyl)-1-(1,2,4-triazol-1-yl)butane-2,3-diol structure
|
Common Name | (2R,3R)-2-(4-chlorophenyl)-3-(4-fluorophenyl)-1-(1,2,4-triazol-1-yl)butane-2,3-diol | ||
|---|---|---|---|---|
| CAS Number | 107680-00-2 | Molecular Weight | 361.79800 | |
| Density | 1.32g/cm3 | Boiling Point | 581.2ºC at 760mmHg | |
| Molecular Formula | C18H17ClFN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 305.3ºC | |
| Name | (2R,3R)-2-(4-chlorophenyl)-3-(4-fluorophenyl)-1-(1,2,4-triazol-1-yl)butane-2,3-diol |
|---|
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 581.2ºC at 760mmHg |
| Molecular Formula | C18H17ClFN3O2 |
| Molecular Weight | 361.79800 |
| Flash Point | 305.3ºC |
| Exact Mass | 361.09900 |
| PSA | 71.17000 |
| LogP | 2.86610 |
| Vapour Pressure | 2.38E-14mmHg at 25°C |
| Index of Refraction | 1.61 |
| InChIKey | ZSZFKFQQLNXTMB-MSOLQXFVSA-N |
| SMILES | CC(O)(c1ccc(F)cc1)C(O)(Cn1cncn1)c1ccc(Cl)cc1 |
|
~22%
(2R,3R)-2-(4-ch... CAS#:107680-00-2 |
| Literature: Ogata; Matsumoto; Takahashi; Shimizu; Kida; Murabayashi; Shiro; Tawara Journal of Medicinal Chemistry, 1987 , vol. 30, # 6 p. 1054 - 1068 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |