(2R,3S)-2-(4-chlorophenyl)-3-(4-fluorophenyl)-1-(1,2,4-triazol-1-yl)pentane-2,3-diol structure
|
Common Name | (2R,3S)-2-(4-chlorophenyl)-3-(4-fluorophenyl)-1-(1,2,4-triazol-1-yl)pentane-2,3-diol | ||
|---|---|---|---|---|
| CAS Number | 107680-07-9 | Molecular Weight | 375.82400 | |
| Density | 1.29g/cm3 | Boiling Point | 587.4ºC at 760mmHg | |
| Molecular Formula | C19H19ClFN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 309ºC | |
| Name | (2R,3S)-2-(4-chlorophenyl)-3-(4-fluorophenyl)-1-(1,2,4-triazol-1-yl)pentane-2,3-diol |
|---|
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 587.4ºC at 760mmHg |
| Molecular Formula | C19H19ClFN3O2 |
| Molecular Weight | 375.82400 |
| Flash Point | 309ºC |
| Exact Mass | 375.11500 |
| PSA | 71.17000 |
| LogP | 3.25620 |
| Vapour Pressure | 1.22E-14mmHg at 25°C |
| Index of Refraction | 1.603 |
| InChIKey | PDFMFDPALQMUDC-OALUTQOASA-N |
| SMILES | CCC(O)(c1ccc(F)cc1)C(O)(Cn1cncn1)c1ccc(Cl)cc1 |
|
~35%
(2R,3S)-2-(4-ch... CAS#:107680-07-9 |
| Literature: Journal of Medicinal Chemistry, , vol. 30, # 6 p. 1054 - 1068 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |