(2S,3R)-2-(4-chlorophenyl)-4-methyl-3-(1,2,4-triazol-1-ylmethyl)pentane-2,3-diol structure
|
Common Name | (2S,3R)-2-(4-chlorophenyl)-4-methyl-3-(1,2,4-triazol-1-ylmethyl)pentane-2,3-diol | ||
|---|---|---|---|---|
| CAS Number | 107680-09-1 | Molecular Weight | 309.79100 | |
| Density | 1.24g/cm3 | Boiling Point | 512.4ºC at 760mmHg | |
| Molecular Formula | C15H20ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 263.7ºC | |
| Name | (2S,3R)-2-(4-chlorophenyl)-4-methyl-3-(1,2,4-triazol-1-ylmethyl)pentane-2,3-diol |
|---|
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 512.4ºC at 760mmHg |
| Molecular Formula | C15H20ClN3O2 |
| Molecular Weight | 309.79100 |
| Flash Point | 263.7ºC |
| Exact Mass | 309.12400 |
| PSA | 71.17000 |
| LogP | 2.22630 |
| Vapour Pressure | 2.53E-11mmHg at 25°C |
| Index of Refraction | 1.584 |
| InChIKey | BPGRKWCPHNQLPC-GJZGRUSLSA-N |
| SMILES | CC(C)C(O)(Cn1cncn1)C(C)(O)c1ccc(Cl)cc1 |
|
~%
(2S,3R)-2-(4-ch... CAS#:107680-09-1 |
| Literature: Ogata; Matsumoto; Takahashi; Shimizu; Kida; Murabayashi; Shiro; Tawara Journal of Medicinal Chemistry, 1987 , vol. 30, # 6 p. 1054 - 1068 |
|
~22%
(2S,3R)-2-(4-ch... CAS#:107680-09-1 |
| Literature: Ogata; Matsumoto; Takahashi; Shimizu; Kida; Murabayashi; Shiro; Tawara Journal of Medicinal Chemistry, 1987 , vol. 30, # 6 p. 1054 - 1068 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |