(2R,3S)-2-(2,4-dichlorophenyl)-3-(4-fluorophenyl)-1-(1,2,4-triazol-1-yl)butane-2,3-diol structure
|
Common Name | (2R,3S)-2-(2,4-dichlorophenyl)-3-(4-fluorophenyl)-1-(1,2,4-triazol-1-yl)butane-2,3-diol | ||
|---|---|---|---|---|
| CAS Number | 107680-10-4 | Molecular Weight | 396.24300 | |
| Density | 1.4g/cm3 | Boiling Point | 607.1ºC at 760mmHg | |
| Molecular Formula | C18H16Cl2FN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 321ºC | |
| Name | (2R,3S)-2-(2,4-dichlorophenyl)-3-(4-fluorophenyl)-1-(1,2,4-triazol-1-yl)butane-2,3-diol |
|---|
| Density | 1.4g/cm3 |
|---|---|
| Boiling Point | 607.1ºC at 760mmHg |
| Molecular Formula | C18H16Cl2FN3O2 |
| Molecular Weight | 396.24300 |
| Flash Point | 321ºC |
| Exact Mass | 395.06000 |
| PSA | 71.17000 |
| LogP | 3.51950 |
| Vapour Pressure | 1.37E-15mmHg at 25°C |
| Index of Refraction | 1.621 |
| InChIKey | VHXNDSDIDKXEFR-ROUUACIJSA-N |
| SMILES | CC(O)(c1ccc(F)cc1)C(O)(Cn1cncn1)c1ccc(Cl)cc1Cl |
|
~49%
(2R,3S)-2-(2,4-... CAS#:107680-10-4 |
| Literature: Ogata; Matsumoto; Takahashi; Shimizu; Kida; Murabayashi; Shiro; Tawara Journal of Medicinal Chemistry, 1987 , vol. 30, # 6 p. 1054 - 1068 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |