(2R,3S)-2-(2,4-dichlorophenyl)-3-phenyl-1-(1,2,4-triazol-1-yl)heptane-2,3-diol
Modify Date: 2024-09-14 16:49:07
(2R,3S)-2-(2,4-dichlorophenyl)-3-phenyl-1-(1,2,4-triazol-1-yl)heptane-2,3-diol structure
|
Common Name | (2R,3S)-2-(2,4-dichlorophenyl)-3-phenyl-1-(1,2,4-triazol-1-yl)heptane-2,3-diol | ||
|---|---|---|---|---|
| CAS Number | 107680-23-9 | Molecular Weight | 420.33200 | |
| Density | 1.28g/cm3 | Boiling Point | 623.6ºC at 760mmHg | |
| Molecular Formula | C21H23Cl2N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 330.9ºC | |
| Name | (2R,3S)-2-(2,4-dichlorophenyl)-3-phenyl-1-(1,2,4-triazol-1-yl)heptane-2,3-diol |
|---|
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 623.6ºC at 760mmHg |
| Molecular Formula | C21H23Cl2N3O2 |
| Molecular Weight | 420.33200 |
| Flash Point | 330.9ºC |
| Exact Mass | 419.11700 |
| PSA | 71.17000 |
| LogP | 4.55070 |
| Vapour Pressure | 2.06E-16mmHg at 25°C |
| Index of Refraction | 1.608 |
| InChIKey | AJBFTKKXGPDMJF-SFTDATJTSA-N |
| SMILES | CCCCC(O)(c1ccccc1)C(O)(Cn1cncn1)c1ccc(Cl)cc1Cl |
|
~%
(2R,3S)-2-(2,4-... CAS#:107680-23-9 |
| Literature: Ogata; Matsumoto; Takahashi; Shimizu; Kida; Murabayashi; Shiro; Tawara Journal of Medicinal Chemistry, 1987 , vol. 30, # 6 p. 1054 - 1068 |
|
~%
(2R,3S)-2-(2,4-... CAS#:107680-23-9 |
| Literature: Ogata; Matsumoto; Takahashi; Shimizu; Kida; Murabayashi; Shiro; Tawara Journal of Medicinal Chemistry, 1987 , vol. 30, # 6 p. 1054 - 1068 |
|
~%
(2R,3S)-2-(2,4-... CAS#:107680-23-9 |
| Literature: Ogata; Matsumoto; Takahashi; Shimizu; Kida; Murabayashi; Shiro; Tawara Journal of Medicinal Chemistry, 1987 , vol. 30, # 6 p. 1054 - 1068 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |