(2S,3R)-2-(4-chlorophenyl)-3-(1,2,4-triazol-1-ylmethyl)heptane-2,3-diol structure
|
Common Name | (2S,3R)-2-(4-chlorophenyl)-3-(1,2,4-triazol-1-ylmethyl)heptane-2,3-diol | ||
|---|---|---|---|---|
| CAS Number | 107680-26-2 | Molecular Weight | 323.81800 | |
| Density | 1.21g/cm3 | Boiling Point | 526.8ºC at 760mmHg | |
| Molecular Formula | C16H22ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 272.4ºC | |
| Name | (2S,3R)-2-(4-chlorophenyl)-3-(1,2,4-triazol-1-ylmethyl)heptane-2,3-diol |
|---|
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 526.8ºC at 760mmHg |
| Molecular Formula | C16H22ClN3O2 |
| Molecular Weight | 323.81800 |
| Flash Point | 272.4ºC |
| Exact Mass | 323.14000 |
| PSA | 71.17000 |
| LogP | 2.76050 |
| Vapour Pressure | 6.28E-12mmHg at 25°C |
| Index of Refraction | 1.577 |
| InChIKey | DSFPPUJPRUNVCI-JKSUJKDBSA-N |
| SMILES | CCCCC(O)(Cn1cncn1)C(C)(O)c1ccc(Cl)cc1 |
|
~48%
(2S,3R)-2-(4-ch... CAS#:107680-26-2 |
| Literature: Journal of Medicinal Chemistry, , vol. 30, # 6 p. 1054 - 1068 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |