3-(dichlorophenylsilyl)propiononitrile structure
|
Common Name | 3-(dichlorophenylsilyl)propiononitrile | ||
|---|---|---|---|---|
| CAS Number | 1077-57-2 | Molecular Weight | 230.16600 | |
| Density | 1.19g/cm3 | Boiling Point | 316.5ºC at 760mmHg | |
| Molecular Formula | C9H9Cl2NSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 145.2ºC | |
| Name | 3-[dichloro(phenyl)silyl]propanenitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 316.5ºC at 760mmHg |
| Molecular Formula | C9H9Cl2NSi |
| Molecular Weight | 230.16600 |
| Flash Point | 145.2ºC |
| Exact Mass | 228.98800 |
| PSA | 23.79000 |
| LogP | 2.72708 |
| Vapour Pressure | 0.000409mmHg at 25°C |
| Index of Refraction | 1.526 |
| InChIKey | NVPJPRQHVOYMHE-UHFFFAOYSA-N |
| SMILES | N#CCC[Si](Cl)(Cl)c1ccccc1 |
| HS Code | 2931900090 |
|---|
|
~%
3-(dichlorophen... CAS#:1077-57-2 |
| Literature: Belyakova,Z.V. et al. J. Gen. Chem. USSR (Engl. Transl.), 1964 , vol. 34, p. 1480 - 1484,1486 - 1489 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| EINECS 214-074-9 |
| Dichlor-<2-cyan-ethyll-phenyl-silan |
| Phenyl-<2-cyan-ethyl>-dichlorsilan |
| <2-Cyan-ethyl>-phenyl-dichlorsilan |