(2R,3S)-2,3-bis(4-chlorophenyl)-1-(1,2,4-triazol-1-yl)butane-2,3-diol structure
|
Common Name | (2R,3S)-2,3-bis(4-chlorophenyl)-1-(1,2,4-triazol-1-yl)butane-2,3-diol | ||
|---|---|---|---|---|
| CAS Number | 107711-02-4 | Molecular Weight | 378.25200 | |
| Density | 1.35g/cm3 | Boiling Point | 604.7ºC at 760 mmHg | |
| Molecular Formula | C18H17Cl2N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 319.5ºC | |
| Name | (2R,3S)-2,3-bis(4-chlorophenyl)-1-(1,2,4-triazol-1-yl)butane-2,3-diol |
|---|
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 604.7ºC at 760 mmHg |
| Molecular Formula | C18H17Cl2N3O2 |
| Molecular Weight | 378.25200 |
| Flash Point | 319.5ºC |
| Exact Mass | 377.07000 |
| PSA | 71.17000 |
| LogP | 3.38040 |
| Vapour Pressure | 1.78E-15mmHg at 25°C |
| Index of Refraction | 1.63 |
| InChIKey | JMZJOQIVTXIKOJ-ROUUACIJSA-N |
| SMILES | CC(O)(c1ccc(Cl)cc1)C(O)(Cn1cncn1)c1ccc(Cl)cc1 |
|
~44%
(2R,3S)-2,3-bis... CAS#:107711-02-4 |
| Literature: Ogata; Matsumoto; Takahashi; Shimizu; Kida; Murabayashi; Shiro; Tawara Journal of Medicinal Chemistry, 1987 , vol. 30, # 6 p. 1054 - 1068 |
|
~%
(2R,3S)-2,3-bis... CAS#:107711-02-4 |
| Literature: Ogata; Matsumoto; Takahashi; Shimizu; Kida; Murabayashi; Shiro; Tawara Journal of Medicinal Chemistry, 1987 , vol. 30, # 6 p. 1054 - 1068 |
|
~%
(2R,3S)-2,3-bis... CAS#:107711-02-4 |
| Literature: Ogata; Matsumoto; Takahashi; Shimizu; Kida; Murabayashi; Shiro; Tawara Journal of Medicinal Chemistry, 1987 , vol. 30, # 6 p. 1054 - 1068 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |