Ethanone, 2,2,2-trifluoro-1-(4-propylphenyl)- (9CI) structure
|
Common Name | Ethanone, 2,2,2-trifluoro-1-(4-propylphenyl)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 107713-67-7 | Molecular Weight | 216.20000 | |
| Density | 1.158g/cm3 | Boiling Point | 243.1ºC at 760mmHg | |
| Molecular Formula | C11H11F3O | Melting Point | N/A | |
| MSDS | USA | Flash Point | 116.1ºC | |
| Name | 2,2,2-Trifluoro-1-(4-propylphenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.158g/cm3 |
|---|---|
| Boiling Point | 243.1ºC at 760mmHg |
| Molecular Formula | C11H11F3O |
| Molecular Weight | 216.20000 |
| Flash Point | 116.1ºC |
| Exact Mass | 216.07600 |
| PSA | 17.07000 |
| LogP | 3.38410 |
| Vapour Pressure | 0.0327mmHg at 25°C |
| Index of Refraction | 1.457 |
| InChIKey | OIHKCVMNWSBPKN-UHFFFAOYSA-N |
| SMILES | CCCc1ccc(C(=O)C(F)(F)F)cc1 |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 4'-n-Propyl-2,2,2-trifluoroacetophenone |