(E)-3-[3-[(4-bromophenyl)sulfanylmethyl]-5-ethoxy-4-hydroxyphenyl]-2-cyanoprop-2-enamide
Modify Date: 2025-08-22 16:19:47
![(E)-3-[3-[(4-bromophenyl)sulfanylmethyl]-5-ethoxy-4-hydroxyphenyl]-2-cyanoprop-2-enamide Structure](https://image.chemsrc.com/caspic/150/107761-27-3.png)
(E)-3-[3-[(4-bromophenyl)sulfanylmethyl]-5-ethoxy-4-hydroxyphenyl]-2-cyanoprop-2-enamide structure
|
Common Name | (E)-3-[3-[(4-bromophenyl)sulfanylmethyl]-5-ethoxy-4-hydroxyphenyl]-2-cyanoprop-2-enamide | ||
|---|---|---|---|---|
| CAS Number | 107761-27-3 | Molecular Weight | 433.31900 | |
| Density | 1.54g/cm3 | Boiling Point | 645.3ºC at 760 mmHg | |
| Molecular Formula | C19H17BrN2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 344.1ºC | |
| Name | (E)-3-[3-[(4-bromophenyl)sulfanylmethyl]-5-ethoxy-4-hydroxyphenyl]-2-cyanoprop-2-enamide |
|---|
| Density | 1.54g/cm3 |
|---|---|
| Boiling Point | 645.3ºC at 760 mmHg |
| Molecular Formula | C19H17BrN2O3S |
| Molecular Weight | 433.31900 |
| Flash Point | 344.1ºC |
| Exact Mass | 432.01400 |
| PSA | 122.63000 |
| LogP | 5.38768 |
| Vapour Pressure | 3E-17mmHg at 25°C |
| Index of Refraction | 1.68 |
| InChIKey | ZQDXSHFHYOZDLU-NTUHNPAUSA-N |
| SMILES | CCOc1cc(C=C(C#N)C(N)=O)cc(CSc2ccc(Br)cc2)c1O |
|
~79%
(E)-3-[3-[(4-br... CAS#:107761-27-3 |
| Literature: Shiraishi; Kameyama; Imai; Domoto; Katsumi; Watanabe Chemical and Pharmaceutical Bulletin, 1988 , vol. 36, # 3 p. 974 - 981 |
|
~%
(E)-3-[3-[(4-br... CAS#:107761-27-3 |
| Literature: Shiraishi; Kameyama; Imai; Domoto; Katsumi; Watanabe Chemical and Pharmaceutical Bulletin, 1988 , vol. 36, # 3 p. 974 - 981 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |