[4-[(E)-3-amino-2-cyano-3-oxoprop-1-enyl]-2-ethoxy-6-(phenylsulfanylmethyl)phenyl] acetate structure
|
Common Name | [4-[(E)-3-amino-2-cyano-3-oxoprop-1-enyl]-2-ethoxy-6-(phenylsulfanylmethyl)phenyl] acetate | ||
|---|---|---|---|---|
| CAS Number | 107788-05-6 | Molecular Weight | 396.46000 | |
| Density | 1.29g/cm3 | Boiling Point | 617.6ºC at 760mmHg | |
| Molecular Formula | C21H20N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 327.3ºC | |
| Name | [4-[(E)-3-amino-2-cyano-3-oxoprop-1-enyl]-2-ethoxy-6-(phenylsulfanylmethyl)phenyl] acetate |
|---|
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 617.6ºC at 760mmHg |
| Molecular Formula | C21H20N2O4S |
| Molecular Weight | 396.46000 |
| Flash Point | 327.3ºC |
| Exact Mass | 396.11400 |
| PSA | 128.70000 |
| LogP | 4.84488 |
| Vapour Pressure | 3.51E-15mmHg at 25°C |
| Index of Refraction | 1.623 |
| InChIKey | ZUFVUSGNBKYJTN-CXUHLZMHSA-N |
| SMILES | CCOc1cc(C=C(C#N)C(N)=O)cc(CSc2ccccc2)c1OC(C)=O |
|
~%
[4-[(E)-3-amino... CAS#:107788-05-6 |
| Literature: Shiraishi; Kameyama; Imai; Domoto; Katsumi; Watanabe Chemical and Pharmaceutical Bulletin, 1988 , vol. 36, # 3 p. 974 - 981 |
|
~%
[4-[(E)-3-amino... CAS#:107788-05-6 |
| Literature: Shiraishi; Kameyama; Imai; Domoto; Katsumi; Watanabe Chemical and Pharmaceutical Bulletin, 1988 , vol. 36, # 3 p. 974 - 981 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |