(E)-2-cyano-3-[3-ethoxy-4-hydroxy-5-[(4-hydroxyphenyl)sulfanylmethyl]phenyl]prop-2-enamide structure
|
Common Name | (E)-2-cyano-3-[3-ethoxy-4-hydroxy-5-[(4-hydroxyphenyl)sulfanylmethyl]phenyl]prop-2-enamide | ||
|---|---|---|---|---|
| CAS Number | 107788-08-9 | Molecular Weight | 370.42200 | |
| Density | 1.39g/cm3 | Boiling Point | 665.8ºC at 760mmHg | |
| Molecular Formula | C19H18N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 356.5ºC | |
| Name | (E)-2-cyano-3-[3-ethoxy-4-hydroxy-5-[(4-hydroxyphenyl)sulfanylmethyl]phenyl]prop-2-enamide |
|---|
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 665.8ºC at 760mmHg |
| Molecular Formula | C19H18N2O4S |
| Molecular Weight | 370.42200 |
| Flash Point | 356.5ºC |
| Exact Mass | 370.09900 |
| PSA | 142.86000 |
| LogP | 4.33078 |
| Vapour Pressure | 2.45E-18mmHg at 25°C |
| Index of Refraction | 1.678 |
| InChIKey | YMONKAACCNVIKX-NTUHNPAUSA-N |
| SMILES | CCOc1cc(C=C(C#N)C(N)=O)cc(CSc2ccc(O)cc2)c1O |
|
~52%
(E)-2-cyano-3-[... CAS#:107788-08-9 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 36, # 3 p. 974 - 981 |
|
~%
(E)-2-cyano-3-[... CAS#:107788-08-9 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 36, # 3 p. 974 - 981 |
|
~%
(E)-2-cyano-3-[... CAS#:107788-08-9 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 36, # 3 p. 974 - 981 |