(R)-(+)-PROPYLENEOXIDE structure
|
Common Name | (R)-(+)-PROPYLENEOXIDE | ||
|---|---|---|---|---|
| CAS Number | 107832-33-7 | Molecular Weight | 222.23700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(1-phenylethyl)butanedioate |
|---|
| Molecular Formula | C12H14O4 |
|---|---|
| Molecular Weight | 222.23700 |
| Exact Mass | 222.08900 |
| PSA | 63.60000 |
| LogP | 2.15560 |
| InChIKey | FDXVETHETURZLC-LHIURRSHSA-L |
| SMILES | CC(c1ccccc1)C(CC(=O)[O-])C(=O)[O-] |
| HS Code | 2918990090 |
|---|
|
~%
(R)-(+)-PROPYLE... CAS#:107832-33-7 |
| Literature: Adani, Sara; Raimondi, Stefano; Forti, Luca; Monti, Daniela; Riva, Sergio Tetrahedron Asymmetry, 2005 , vol. 16, # 14 p. 2509 - 2513 |
|
~%
(R)-(+)-PROPYLE... CAS#:107832-33-7 |
| Literature: Gutman, Arie L.; Brenner, Dov; Boltanski, Aviv Tetrahedron: Asymmetry, 1993 , vol. 4, # 5 p. 839 - 844 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |