1-Methyl-2-oxo-3-(2-oxopropyl)-2,3-dihydro-1H-indol-3-yl acetate structure
|
Common Name | 1-Methyl-2-oxo-3-(2-oxopropyl)-2,3-dihydro-1H-indol-3-yl acetate | ||
|---|---|---|---|---|
| CAS Number | 107864-78-8 | Molecular Weight | 261.27300 | |
| Density | 1.26g/cm3 | Boiling Point | 455.5ºC at 760 mmHg | |
| Molecular Formula | C14H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.3ºC | |
| Name | 1-Methyl-2-oxo-3-(2-oxopropyl)-2,3-dihydro-1H-indol-3-yl acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 455.5ºC at 760 mmHg |
| Molecular Formula | C14H15NO4 |
| Molecular Weight | 261.27300 |
| Flash Point | 229.3ºC |
| Exact Mass | 261.10000 |
| PSA | 63.68000 |
| LogP | 1.46550 |
| Vapour Pressure | 1.75E-08mmHg at 25°C |
| Index of Refraction | 1.569 |
| InChIKey | UUOCWINRTUMHAS-UHFFFAOYSA-N |
| SMILES | CC(=O)CC1(OC(C)=O)C(=O)N(C)c2ccccc21 |
| HS Code | 2915390090 |
|---|
| HS Code | 2915390090 |
|---|---|
| Summary | 2915390090. esters of acetic acid. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:5.5%. General tariff:30.0% |
| 1-Methyl-3-acetoxy-3-acetonyloxindole |