nephtheoxydiol structure
|
Common Name | nephtheoxydiol | ||
|---|---|---|---|---|
| CAS Number | 107870-28-0 | Molecular Weight | 254.36500 | |
| Density | 1.02g/cm3 | Boiling Point | 378.8ºC at 760mmHg | |
| Molecular Formula | C15H26O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.9ºC | |
| Name | (1R,2Z,4R,8S)-8-hydroperoxy-1-methyl-7-methylidene-4-propan-2-ylcyclodec-2-en-1-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.02g/cm3 |
|---|---|
| Boiling Point | 378.8ºC at 760mmHg |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.36500 |
| Flash Point | 182.9ºC |
| Exact Mass | 254.18800 |
| PSA | 49.69000 |
| LogP | 3.55420 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.503 |
| InChIKey | IYQPDCHHTWJQQK-LJBASXIBSA-N |
| SMILES | C=C1CCC(C(C)C)C=CC(C)(O)CCC1OO |
| HS Code | 2909600000 |
|---|
| HS Code | 2909600000 |
|---|---|
| Summary | 2909600000 alcohol peroxides, ether peroxides, ketone peroxides and their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| Nephtheoxydiol |