5-Pyrimidinepropanoicacid, 2-amino-1,6-dihydro-4-methyl-6-thioxo- structure
|
Common Name | 5-Pyrimidinepropanoicacid, 2-amino-1,6-dihydro-4-methyl-6-thioxo- | ||
|---|---|---|---|---|
| CAS Number | 1079-42-1 | Molecular Weight | 213.25700 | |
| Density | 1.5g/cm3 | Boiling Point | 420.5ºC at 760mmHg | |
| Molecular Formula | C8H11N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.1ºC | |
| Name | 3-(2-amino-6-methyl-4-sulfanylidene-1H-pyrimidin-5-yl)propanoic acid |
|---|
| Density | 1.5g/cm3 |
|---|---|
| Boiling Point | 420.5ºC at 760mmHg |
| Molecular Formula | C8H11N3O2S |
| Molecular Weight | 213.25700 |
| Flash Point | 208.1ºC |
| Exact Mass | 213.05700 |
| PSA | 124.09000 |
| LogP | 1.62820 |
| Vapour Pressure | 3E-08mmHg at 25°C |
| Index of Refraction | 1.684 |
| InChIKey | JJOFZKIXHUDVKL-UHFFFAOYSA-N |
| SMILES | Cc1[nH]c(N)nc(=S)c1CCC(=O)O |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |