(4-chloro-3,5-dimethylpyrazol-1-yl)-(3,4,5-trimethoxyphenyl)methanone structure
|
Common Name | (4-chloro-3,5-dimethylpyrazol-1-yl)-(3,4,5-trimethoxyphenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 108132-60-1 | Molecular Weight | 324.75900 | |
| Density | 1.27g/cm3 | Boiling Point | 495.1ºC at 760mmHg | |
| Molecular Formula | C15H17ClN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 253.2ºC | |
| Name | (4-chloro-3,5-dimethylpyrazol-1-yl)-(3,4,5-trimethoxyphenyl)methanone |
|---|
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 495.1ºC at 760mmHg |
| Molecular Formula | C15H17ClN2O4 |
| Molecular Weight | 324.75900 |
| Flash Point | 253.2ºC |
| Exact Mass | 324.08800 |
| PSA | 62.58000 |
| LogP | 2.86760 |
| Vapour Pressure | 6.06E-10mmHg at 25°C |
| Index of Refraction | 1.56 |
| InChIKey | DESMUKMRRZCSDV-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)n2nc(C)c(Cl)c2C)cc(OC)c1OC |
|
~75%
(4-chloro-3,5-d... CAS#:108132-60-1 |
| Literature: Mazzone; Puglisi; Corsaro; et al. European Journal of Medicinal Chemistry, 1986 , vol. 21, # 4 p. 277 - 284 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |