6-chloro-4-(5-chloro-1-benzofuran-2-yl)chromen-2-one structure
|
Common Name | 6-chloro-4-(5-chloro-1-benzofuran-2-yl)chromen-2-one | ||
|---|---|---|---|---|
| CAS Number | 108154-57-0 | Molecular Weight | 331.15000 | |
| Density | 1.504g/cm3 | Boiling Point | 508.6ºC at 760mmHg | |
| Molecular Formula | C17H8Cl2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 261.4ºC | |
| Name | 6-chloro-4-(5-chloro-1-benzofuran-2-yl)chromen-2-one |
|---|
| Density | 1.504g/cm3 |
|---|---|
| Boiling Point | 508.6ºC at 760mmHg |
| Molecular Formula | C17H8Cl2O3 |
| Molecular Weight | 331.15000 |
| Flash Point | 261.4ºC |
| Exact Mass | 329.98500 |
| PSA | 43.35000 |
| LogP | 5.51300 |
| Vapour Pressure | 1.83E-10mmHg at 25°C |
| Index of Refraction | 1.69 |
| InChIKey | FYSZZCKHCVODDJ-UHFFFAOYSA-N |
| SMILES | O=c1cc(-c2cc3cc(Cl)ccc3o2)c2cc(Cl)ccc2o1 |
|
~76%
6-chloro-4-(5-c... CAS#:108154-57-0 |
| Literature: Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, , vol. 25, p. 779 - 781 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |