1,3-Benzenedisulfonamide,4-amino-5-chloro- structure
|
Common Name | 1,3-Benzenedisulfonamide,4-amino-5-chloro- | ||
|---|---|---|---|---|
| CAS Number | 1083-36-9 | Molecular Weight | 285.72800 | |
| Density | 1.768g/cm3 | Boiling Point | 606.5ºC at 760 mmHg | |
| Molecular Formula | C6H8ClN3O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 320.6ºC | |
| Name | 4-amino-5-chlorobenzene-1,3-disulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.768g/cm3 |
|---|---|
| Boiling Point | 606.5ºC at 760 mmHg |
| Molecular Formula | C6H8ClN3O4S2 |
| Molecular Weight | 285.72800 |
| Flash Point | 320.6ºC |
| Exact Mass | 284.96400 |
| PSA | 163.10000 |
| LogP | 3.36040 |
| Vapour Pressure | 1.17E-14mmHg at 25°C |
| Index of Refraction | 1.666 |
| InChIKey | SWTAIRDZECAFHR-UHFFFAOYSA-N |
| SMILES | Nc1c(Cl)cc(S(N)(=O)=O)cc1S(N)(=O)=O |
|
~%
1,3-Benzenedisu... CAS#:1083-36-9 |
| Literature: Novello,F.C. et al. Journal of Organic Chemistry, 1960 , vol. 25, p. 965 - 970 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| 6-Chlor-2.4-disulfamoyl-anilin |
| 6-Chlor-2,4-disulfamyl-anilin |
| 6-Chlor-2,4-bis-sulfamoyl-anilin |
| 4-Amino-5-chlor-benzol-1,3-disulfonsaeure-diamid |
| 4-amino-5-chloro-benzene-1,3-disulfonic acid diamide |