5-(hydroxymethyl)-11-methyl-6H-pyrido(4,3-b)carbazole N-methylcarbamate structure
|
Common Name | 5-(hydroxymethyl)-11-methyl-6H-pyrido(4,3-b)carbazole N-methylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 108320-79-2 | Molecular Weight | 337.37200 | |
| Density | 1.323g/cm3 | Boiling Point | 611.3ºC at 760 mmHg | |
| Molecular Formula | C19H19N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 323.5ºC | |
| Name | methylcarbamic acid,(11-methyl-6H-pyrido[4,3-b]carbazol-5-yl)methanol |
|---|
| Density | 1.323g/cm3 |
|---|---|
| Boiling Point | 611.3ºC at 760 mmHg |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.37200 |
| Flash Point | 323.5ºC |
| Exact Mass | 337.14300 |
| PSA | 98.24000 |
| LogP | 3.94470 |
| Vapour Pressure | 6.99E-15mmHg at 25°C |
| Index of Refraction | 1.733 |
| InChIKey | JEURWCFQOJUTQI-UHFFFAOYSA-N |
| SMILES | CNC(=O)OCc1c2ccncc2c(C)c2c1[nH]c1ccccc12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |