(E)-12-hydroxyoctadec-9-enoic acid, sodium salt structure
|
Common Name | (E)-12-hydroxyoctadec-9-enoic acid, sodium salt | ||
|---|---|---|---|---|
| CAS Number | 108321-51-3 | Molecular Weight | 321.45100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H34NaO3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
Use of (E)-12-hydroxyoctadec-9-enoic acid, sodium salt(E)-12-hydroxyoctadec-9-enoic acid, sodium salt is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | Ricinelaidic acid sodium salt |
|---|---|
| Synonym | More Synonyms |
| Description | (E)-12-hydroxyoctadec-9-enoic acid, sodium salt is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Molecular Formula | C18H34NaO3 |
|---|---|
| Molecular Weight | 321.45100 |
| Exact Mass | 321.24100 |
| PSA | 57.53000 |
| LogP | 5.07930 |
| InChIKey | ZCEUYFQZJDGDEF-NBYYMMLRSA-N |
| SMILES | CCCCCCC(O)CC=CCCCCCCCC(=O)O.[Na] |
| RIDADR | NONH for all modes of transport |
|---|---|
| WGK Germany | 3 |
| (R)-12-Hydroxy-9(E)-octadecenoic acid |
| (E)-12-hydroxyoctadec-9-enoic acid,sodium |