TOLUENE-4-SULFONIC ACID 2-TERT-BUTOXY ETHYL ESTER
TOLUENE-4-SULFONIC ACID 2-TERT-BUTOXY ETHYL ESTER structure
|
Common Name | TOLUENE-4-SULFONIC ACID 2-TERT-BUTOXY ETHYL ESTER | ||
|---|---|---|---|---|
| CAS Number | 108366-80-9 | Molecular Weight | 272.36100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H20O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Toluene-4-sulfonic acid 2-tertiary-butoxy ethyl ester |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H20O4S |
|---|---|
| Molecular Weight | 272.36100 |
| Exact Mass | 272.10800 |
| PSA | 60.98000 |
| LogP | 3.59620 |
| InChIKey | GPXQMVPLPIALKX-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCCOC(C)(C)C)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~92%
TOLUENE-4-SULFO... CAS#:108366-80-9 |
| Literature: Ouchi, Mikio; Inoue, Yoshihisa; Wada, Kazuhito; Iketani, Shin-ichi; Hakushi, Tadao; Weber, Edwin Journal of Organic Chemistry, 1987 , vol. 52, # 12 p. 2420 - 2427 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| toluene-4-sulfonic acid 2-tert-butoxy ethyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Toluene-4-sulfonic acid 2-tertiary-butoxy ethyl ester? |
| A: Molecular formula of Toluene-4-sulfonic acid 2-tertiary-butoxy ethyl ester is C13H20O4S. |
| Q: What are the upstream materials of Toluene-4-sulfonic acid 2-tertiary-butoxy ethyl ester? |
| A: Related upstream materials(CAS) of Toluene-4-sulfonic acid 2-tertiary-butoxy ethyl ester: 7580-85-0;98-59-9. |
| Q: What is the English name of Toluene-4-sulfonic acid 2-tertiary-butoxy ethyl ester? |
| A: The English name of Toluene-4-sulfonic acid 2-tertiary-butoxy ethyl ester is Toluene-4-sulfonic acid 2-tertiary-butoxy ethyl ester. |
| Q: What is the SMILES notation of Toluene-4-sulfonic acid 2-tertiary-butoxy ethyl ester? |
| A: SMILES notation of Toluene-4-sulfonic acid 2-tertiary-butoxy ethyl ester is Cc1ccc(S(=O)(=O)OCCOC(C)(C)C)cc1. |
| Q: What is the CAS number of Toluene-4-sulfonic acid 2-tertiary-butoxy ethyl ester? |
| A: CAS number of Toluene-4-sulfonic acid 2-tertiary-butoxy ethyl ester is 108366-80-9. |
| Q: What is the LogP of Toluene-4-sulfonic acid 2-tertiary-butoxy ethyl ester? |
| A: LogP of Toluene-4-sulfonic acid 2-tertiary-butoxy ethyl ester is 3.59620. |
| Q: What is the InChIKey of Toluene-4-sulfonic acid 2-tertiary-butoxy ethyl ester? |
| A: InChIKey of Toluene-4-sulfonic acid 2-tertiary-butoxy ethyl ester is GPXQMVPLPIALKX-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of Toluene-4-sulfonic acid 2-tertiary-butoxy ethyl ester? |
| A: Polar surface area (PSA) of Toluene-4-sulfonic acid 2-tertiary-butoxy ethyl ester is 60.98000. |
| Q: What English synonyms does Toluene-4-sulfonic acid 2-tertiary-butoxy ethyl ester have? |
| A: English synonyms of Toluene-4-sulfonic acid 2-tertiary-butoxy ethyl ester: toluene-4-sulfonic acid 2-tert-butoxy ethyl ester. |
| Q: What is the Chinese name of 108366-80-9? |
| A: Chinese name of 108366-80-9 is 108366-80-9. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |