7-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylic acid structure
|
Common Name | 7-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 108437-28-1 | Molecular Weight | 359.39500 | |
| Density | 1.41g/cm3 | Boiling Point | 565.9ºC at 760mmHg | |
| Molecular Formula | C19H22FN3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 296ºC | |
| Name | 7-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.41g/cm3 |
|---|---|
| Boiling Point | 565.9ºC at 760mmHg |
| Molecular Formula | C19H22FN3O3 |
| Molecular Weight | 359.39500 |
| Flash Point | 296ºC |
| Exact Mass | 359.16500 |
| PSA | 65.78000 |
| LogP | 2.14600 |
| Vapour Pressure | 1.21E-13mmHg at 25°C |
| Index of Refraction | 1.66 |
| InChIKey | UBGCCYGMLOBJOJ-UHFFFAOYSA-N |
| SMILES | CCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCN4CCC3CC4)cc21 |
|
~84%
7-(1,4-diazabic... CAS#:108437-28-1 |
| Literature: McGuirk; Jefson; Mann; Elliott; Chang; Cisek; Cornell; Gootz; Haskell; Hindahl; LaFleur; Rosenfeld; Shryock; Silvia; Weber Journal of Medicinal Chemistry, 1992 , vol. 35, # 4 p. 611 - 620 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Binfloxacin |