5-Chloro-3-hydroxy-3-(trifluoromethyl)indolin-2-one
Modify Date: 2026-07-05 16:09:50
5-Chloro-3-hydroxy-3-(trifluoromethyl)indolin-2-one structure
|
Common Name | 5-Chloro-3-hydroxy-3-(trifluoromethyl)indolin-2-one | ||
|---|---|---|---|---|
| CAS Number | 108440-33-1 | Molecular Weight | 251.59 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H5ClF3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-Chloro-3-hydroxy-3-(trifluoromethyl)indolin-2-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H5ClF3NO2 |
|---|---|
| Molecular Weight | 251.59 |
| InChIKey | PVEZDIBAGODJCC-UHFFFAOYSA-N |
| SMILES | O=C1Nc2ccc(Cl)cc2C1(O)C(F)(F)F |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Cytotoxicity against Chlorocebus aethiops (African green monkey) Vero cells after 72 ...
Source: ChEMBL
Target: Vero
External Id: CHEMBL3057584
|
|
Name: Inhibition of RNA-dependent DNA polymerase activity of Human immunodeficiency virus 1...
Source: ChEMBL
Target: Reverse transcriptase/RNaseH
External Id: CHEMBL3057585
|
|
Name: HIV-1 Reverse Transcriptase Assay from Article 10.1007/s00044-007-9004-0: "Design, sy...
Source: BindingDB
Target: N/A
External Id: BindingDB_5758_1
|
|
Name: Inhibition of HIV1 reverse transcriptase
Source: ChEMBL
Target: Reverse transcriptase/RNaseH
External Id: CHEMBL3755387
|
Total 6, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 5-Chloro-3-hydroxy-3-(trifluoromethyl)indolin-2-one? |
| A: SMILES notation of 5-Chloro-3-hydroxy-3-(trifluoromethyl)indolin-2-one is O=C1Nc2ccc(Cl)cc2C1(O)C(F)(F)F. |
| Q: What is the molecular weight of 5-Chloro-3-hydroxy-3-(trifluoromethyl)indolin-2-one? |
| A: Molecular weight of 5-Chloro-3-hydroxy-3-(trifluoromethyl)indolin-2-one is 251.59. |
| Q: What is the Chinese name of 108440-33-1? |
| A: Chinese name of 108440-33-1 is 108440-33-1. |
| Q: What is the English name of 5-Chloro-3-hydroxy-3-(trifluoromethyl)indolin-2-one? |
| A: The English name of 5-Chloro-3-hydroxy-3-(trifluoromethyl)indolin-2-one is 5-Chloro-3-hydroxy-3-(trifluoromethyl)indolin-2-one. |
| Q: What is the CAS number of 5-Chloro-3-hydroxy-3-(trifluoromethyl)indolin-2-one? |
| A: CAS number of 5-Chloro-3-hydroxy-3-(trifluoromethyl)indolin-2-one is 108440-33-1. |
| Q: What is the InChIKey of 5-Chloro-3-hydroxy-3-(trifluoromethyl)indolin-2-one? |
| A: InChIKey of 5-Chloro-3-hydroxy-3-(trifluoromethyl)indolin-2-one is PVEZDIBAGODJCC-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 5-Chloro-3-hydroxy-3-(trifluoromethyl)indolin-2-one? |
| A: Molecular formula of 5-Chloro-3-hydroxy-3-(trifluoromethyl)indolin-2-one is C9H5ClF3NO2. |