(S)-CR8 structure
|
Common Name | (S)-CR8 | ||
|---|---|---|---|---|
| CAS Number | 1084893-56-0 | Molecular Weight | 431.53300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H29N7O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of (S)-CR8(S)-CR8 is the S-isomer of CR8. (S)-CR8 is a potent and selective CDK inhibitor with IC50s of 0.060, 0.080, 0.11, 0.12, and 0.15 μM for CDK2/cyclin E, CDK2/cyclin A, CDK9/cyclin T, CDK5/p25, and CDK1/cyclin B, respectively. (S)-CR8 reduces SH-SY5Y cells survival (IC50 0.40 μM)[1]. |
| Name | (2S)-2-[[9-propan-2-yl-6-[(4-pyridin-2-ylphenyl)methylamino]purin-2-yl]amino]butan-1-ol |
|---|---|
| Synonym | More Synonyms |
| Description | (S)-CR8 is the S-isomer of CR8. (S)-CR8 is a potent and selective CDK inhibitor with IC50s of 0.060, 0.080, 0.11, 0.12, and 0.15 μM for CDK2/cyclin E, CDK2/cyclin A, CDK9/cyclin T, CDK5/p25, and CDK1/cyclin B, respectively. (S)-CR8 reduces SH-SY5Y cells survival (IC50 0.40 μM)[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C24H29N7O |
|---|---|
| Molecular Weight | 431.53300 |
| Exact Mass | 431.24300 |
| PSA | 104.01000 |
| LogP | 3.75900 |
| InChIKey | HOCBJBNQIQQQGT-IBGZPJMESA-N |
| SMILES | CCC(CO)Nc1nc(NCc2ccc(-c3ccccn3)cc2)c2ncn(C(C)C)c2n1 |
| HMS3229B15 |
| 3lq5 |
| SLQ |