Naphthalene,1,2-dihydro-1,2-bis(trimethylsilyl)- structure
|
Common Name | Naphthalene,1,2-dihydro-1,2-bis(trimethylsilyl)- | ||
|---|---|---|---|---|
| CAS Number | 1085-99-0 | Molecular Weight | 274.54900 | |
| Density | 0.91g/cm3 | Boiling Point | 323.7ºC at 760 mmHg | |
| Molecular Formula | C16H26Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 133.5ºC | |
| Name | trimethyl-(1-trimethylsilyl-1,2-dihydronaphthalen-2-yl)silane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.91g/cm3 |
|---|---|
| Boiling Point | 323.7ºC at 760 mmHg |
| Molecular Formula | C16H26Si2 |
| Molecular Weight | 274.54900 |
| Flash Point | 133.5ºC |
| Exact Mass | 274.15700 |
| LogP | 5.47830 |
| Vapour Pressure | 0.000488mmHg at 25°C |
| Index of Refraction | 1.499 |
| InChIKey | XJQWQCFYYIJOFL-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C1C=Cc2ccccc2C1[Si](C)(C)C |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 1,2-Bis-trimethylsilyl-1,2-dihydro-naphthalin |
| 1,2-bis(trimethylsilyl)-1,2-dihydronaphthalene |