3-(2-aminoethyl)-4-[3-(2-aminoethyl)-5-hydroxy-1H-indol-4-yl]-1H-indol-5-ol structure
|
Common Name | 3-(2-aminoethyl)-4-[3-(2-aminoethyl)-5-hydroxy-1H-indol-4-yl]-1H-indol-5-ol | ||
|---|---|---|---|---|
| CAS Number | 108535-01-9 | Molecular Weight | 350.41400 | |
| Density | 1.404g/cm3 | Boiling Point | 689.7ºC at 760 mmHg | |
| Molecular Formula | C20H22N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 370.9ºC | |
| Name | 3-(2-aminoethyl)-4-[3-(2-aminoethyl)-5-hydroxy-1H-indol-4-yl]-1H-indol-5-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.404g/cm3 |
|---|---|
| Boiling Point | 689.7ºC at 760 mmHg |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.41400 |
| Flash Point | 370.9ºC |
| Exact Mass | 350.17400 |
| PSA | 124.08000 |
| LogP | 4.13040 |
| Vapour Pressure | 1.17E-19mmHg at 25°C |
| Index of Refraction | 1.786 |
| InChIKey | KEVPJLBSMTXTHH-UHFFFAOYSA-N |
| SMILES | NCCc1c[nH]c2ccc(O)c(-c3c(O)ccc4[nH]cc(CCN)c34)c12 |
| HS Code | 2933990090 |
|---|
|
~%
3-(2-aminoethyl... CAS#:108535-01-9 |
| Literature: Antuna-Jimenez, Daniel; Blanco-Lopez, M. Carmen; Miranda-Ordieres, Arturo J.; Lobo-Castanon, Maria Jesus Polymer (United Kingdom), 2014 , vol. 55, # 5 p. 1113 - 1119 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5,5'-Dihydroxy-4,4'-bitryptamine |