Dichloro-4-hydroxy-3,5-dimethoxybenzeneacetic acid
Modify Date: 2026-07-10 20:57:13
Dichloro-4-hydroxy-3,5-dimethoxybenzeneacetic acid structure
|
Common Name | Dichloro-4-hydroxy-3,5-dimethoxybenzeneacetic acid | ||
|---|---|---|---|---|
| CAS Number | 108572-08-3 | Molecular Weight | 281.09 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10Cl2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Dichloro-4-hydroxy-3,5-dimethoxybenzeneacetic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H10Cl2O5 |
|---|---|
| Molecular Weight | 281.09 |
| InChIKey | BBKXXSBAFNYOTE-UHFFFAOYSA-N |
| SMILES | COc1c(O)c(OC)c(Cl)c(CC(=O)O)c1Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Dichloro-4-hydroxy-3,5-dimethoxybenzeneacetic acid? |
| A: Molecular weight of Dichloro-4-hydroxy-3,5-dimethoxybenzeneacetic acid is 281.09. |
| Q: What is the Chinese name of 108572-08-3? |
| A: Chinese name of 108572-08-3 is 108572-08-3. |
| Q: What is the InChIKey of Dichloro-4-hydroxy-3,5-dimethoxybenzeneacetic acid? |
| A: InChIKey of Dichloro-4-hydroxy-3,5-dimethoxybenzeneacetic acid is BBKXXSBAFNYOTE-UHFFFAOYSA-N. |
| Q: What is the CAS number of Dichloro-4-hydroxy-3,5-dimethoxybenzeneacetic acid? |
| A: CAS number of Dichloro-4-hydroxy-3,5-dimethoxybenzeneacetic acid is 108572-08-3. |
| Q: What is the molecular formula of Dichloro-4-hydroxy-3,5-dimethoxybenzeneacetic acid? |
| A: Molecular formula of Dichloro-4-hydroxy-3,5-dimethoxybenzeneacetic acid is C10H10Cl2O5. |
| Q: What is the SMILES notation of Dichloro-4-hydroxy-3,5-dimethoxybenzeneacetic acid? |
| A: SMILES notation of Dichloro-4-hydroxy-3,5-dimethoxybenzeneacetic acid is COc1c(O)c(OC)c(Cl)c(CC(=O)O)c1Cl. |
| Q: What is the English name of Dichloro-4-hydroxy-3,5-dimethoxybenzeneacetic acid? |
| A: The English name of Dichloro-4-hydroxy-3,5-dimethoxybenzeneacetic acid is Dichloro-4-hydroxy-3,5-dimethoxybenzeneacetic acid. |