1H-Imidazole-4,5-dicarboxylicacid, 1-methyl-2-(methylthio)-, 4,5-diethyl ester structure
|
Common Name | 1H-Imidazole-4,5-dicarboxylicacid, 1-methyl-2-(methylthio)-, 4,5-diethyl ester | ||
|---|---|---|---|---|
| CAS Number | 1086-05-1 | Molecular Weight | 272.32100 | |
| Density | 1.26g/cm3 | Boiling Point | 386.3ºC at 760mmHg | |
| Molecular Formula | C11H16N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.4ºC | |
| Name | diethyl 1-methyl-2-methylsulfanylimidazole-4,5-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 386.3ºC at 760mmHg |
| Molecular Formula | C11H16N2O4S |
| Molecular Weight | 272.32100 |
| Flash Point | 187.4ºC |
| Exact Mass | 272.08300 |
| PSA | 95.72000 |
| LogP | 1.49540 |
| Vapour Pressure | 3.58E-06mmHg at 25°C |
| Index of Refraction | 1.556 |
| InChIKey | QIQRTQYTQIONBC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1nc(SC)n(C)c1C(=O)OCC |
| HS Code | 2933290090 |
|---|
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-methyl-2-methylsulfanyl-1H-imidazole-4,5-dicarboxylic acid diethyl ester |
| 2-Methylmercapto-1-methyl-4,5-bis-ethoxycarbonyl-imidazol |
| diethyl 1-methyl-2-(methylthio)imidazole-4,5-dicarboxylate |
| diethyl 1-methyl-2-(methylthio)-4,5-imidazoledicarboxylate |
| HMS2885I16 |
| Diethyl 1-methyl-2-(methylthio)-1H-imidazole-4,5-dicarboxylate |