5-chloro-4-[(3-ethoxy-4-methoxyphenyl)methylamino]-1H-pyridazin-6-one structure
|
Common Name | 5-chloro-4-[(3-ethoxy-4-methoxyphenyl)methylamino]-1H-pyridazin-6-one | ||
|---|---|---|---|---|
| CAS Number | 108616-42-8 | Molecular Weight | 309.74800 | |
| Density | 1.32g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H16ClN3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-chloro-4-[(3-ethoxy-4-methoxyphenyl)methylamino]-1H-pyridazin-6-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32g/cm3 |
|---|---|
| Molecular Formula | C14H16ClN3O3 |
| Molecular Weight | 309.74800 |
| Exact Mass | 309.08800 |
| PSA | 76.50000 |
| LogP | 2.92800 |
| Index of Refraction | 1.593 |
| InChIKey | MLZKFBZEYADEIN-UHFFFAOYSA-N |
| SMILES | CCOc1cc(CNc2cn[nH]c(=O)c2Cl)ccc1OC |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Chloro-5-(3-ethoxy-4-methoxybenzylamino)-3-(2H)-pyridazinone |
| Nip 502 |
| 3(2H)-Pyridazinone,4-chloro-5-(((3-ethoxy-4-methoxyphenyl)methyl)amino) |
| 4-Chloro-5-(((3-ethoxy-4-methoxyphenyl)methyl)amino)-3(2H)-pyridazinone |