Trimethyl[(2,3,4,5,6-pentakis([(trimethylsilyl)oxy]methyl)benzyl)oxy]s ilane structure
|
Common Name | Trimethyl[(2,3,4,5,6-pentakis([(trimethylsilyl)oxy]methyl)benzyl)oxy]s ilane | ||
|---|---|---|---|---|
| CAS Number | 108638-04-6 | Molecular Weight | 691.35400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H66O6Si6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethyl-[[2,3,4,5,6-pentakis(trimethylsilyloxymethyl)phenyl]methoxy]silane |
|---|
| Molecular Formula | C30H66O6Si6 |
|---|---|
| Molecular Weight | 691.35400 |
| Exact Mass | 690.34700 |
| PSA | 55.38000 |
| LogP | 9.79560 |
| InChIKey | ZPCGFDMAXYJGDX-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)OCc1c(CO[Si](C)(C)C)c(CO[Si](C)(C)C)c(CO[Si](C)(C)C)c(CO[Si](C)(C)C)c1CO[Si](C)(C)C |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |