3-Chloro-1H-indazole-6-carboxylic acid structure
|
Common Name | 3-Chloro-1H-indazole-6-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 1086391-21-0 | Molecular Weight | 196.590 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 472.1±25.0 °C at 760 mmHg | |
| Molecular Formula | C8H5ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.3±23.2 °C | |
| Name | 3-chloro-2H-indazole-6-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 472.1±25.0 °C at 760 mmHg |
| Molecular Formula | C8H5ClN2O2 |
| Molecular Weight | 196.590 |
| Flash Point | 239.3±23.2 °C |
| Exact Mass | 196.003952 |
| PSA | 65.98000 |
| LogP | 2.39 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.744 |
| InChIKey | JVAKHZOIUAECGG-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc2c(Cl)[nH]nc2c1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Indazole-6-carboxylic acid, 3-chloro- |
| 3-Chloro-1H-indazole-6-carboxylic acid |
| 3-Chloro 1H-indazole-6-carboxylic acid |