4-[(2-chlorophenoxy)methyl]-1-phenyltriazole
![4-[(2-chlorophenoxy)methyl]-1-phenyltriazole Structure](https://image.chemsrc.com/caspic/396/108656-89-9.png)
4-[(2-chlorophenoxy)methyl]-1-phenyltriazole structure
|
Common Name | 4-[(2-chlorophenoxy)methyl]-1-phenyltriazole | ||
|---|---|---|---|---|
| CAS Number | 108656-89-9 | Molecular Weight | 285.72800 | |
| Density | 1.27g/cm3 | Boiling Point | 458.9ºC at 760 mmHg | |
| Molecular Formula | C15H12ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231.3ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-[(2-chlorophenoxy)methyl]-1-phenyltriazole |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 458.9ºC at 760 mmHg |
| Molecular Formula | C15H12ClN3O |
| Molecular Weight | 285.72800 |
| Flash Point | 231.3ºC |
| Exact Mass | 285.06700 |
| PSA | 39.94000 |
| LogP | 3.49970 |
| Vapour Pressure | 1.32E-08mmHg at 25°C |
| Index of Refraction | 1.631 |
| InChIKey | XAXUHSZUVAIDIF-UHFFFAOYSA-N |
| SMILES | Clc1ccccc1OCc1cn(-c2ccccc2)nn1 |
This table summarizes toxicological test data, acute & chronic toxicity and ecological hazard parameters for this chemical.
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1H-1,2,3-Triazole,4-[(2-chlorophenoxy)methyl]-1-phenyl |
| 1-phenyl-4-(2-chlorophenoxymethylene)-1,2,3-triazole |
| 4-((2-Chlorophenoxy)methyl)-1-phenyl-1H-1,2,3-triazole |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 4-[(2-chlorophenoxy)methyl]-1-phenyltriazole have? |
| A: English synonyms of 4-[(2-chlorophenoxy)methyl]-1-phenyltriazole: 1H-1,2,3-Triazole,4-[(2-chlorophenoxy)methyl]-1-phenyl, 1-phenyl-4-(2-chlorophenoxymethylene)-1,2,3-triazole, 4-((2-Chlorophenoxy)methyl)-1-phenyl-1H-1,2,3-triazole. |
| Q: What is the InChIKey of 4-[(2-chlorophenoxy)methyl]-1-phenyltriazole? |
| A: InChIKey of 4-[(2-chlorophenoxy)methyl]-1-phenyltriazole is XAXUHSZUVAIDIF-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 4-[(2-chlorophenoxy)methyl]-1-phenyltriazole? |
| A: Molecular weight of 4-[(2-chlorophenoxy)methyl]-1-phenyltriazole is 285.72800. |
| Q: What is the boiling point of 4-[(2-chlorophenoxy)methyl]-1-phenyltriazole? |
| A: Boiling point of 4-[(2-chlorophenoxy)methyl]-1-phenyltriazole is 458.9ºC at 760 mmHg. |
| Q: What is the polar surface area (PSA) of 4-[(2-chlorophenoxy)methyl]-1-phenyltriazole? |
| A: Polar surface area (PSA) of 4-[(2-chlorophenoxy)methyl]-1-phenyltriazole is 39.94000. |
| Q: What is the LogP of 4-[(2-chlorophenoxy)methyl]-1-phenyltriazole? |
| A: LogP of 4-[(2-chlorophenoxy)methyl]-1-phenyltriazole is 3.49970. |
| Q: What is the CAS number of 4-[(2-chlorophenoxy)methyl]-1-phenyltriazole? |
| A: CAS number of 4-[(2-chlorophenoxy)methyl]-1-phenyltriazole is 108656-89-9. |
| Q: What is the molecular formula of 4-[(2-chlorophenoxy)methyl]-1-phenyltriazole? |
| A: Molecular formula of 4-[(2-chlorophenoxy)methyl]-1-phenyltriazole is C15H12ClN3O. |
| Q: What is the Chinese name of 108656-89-9? |
| A: Chinese name of 108656-89-9 is 108656-89-9. |
| Q: What is the SMILES notation of 4-[(2-chlorophenoxy)methyl]-1-phenyltriazole? |
| A: SMILES notation of 4-[(2-chlorophenoxy)methyl]-1-phenyltriazole is Clc1ccccc1OCc1cn(-c2ccccc2)nn1. |