Meprophendiol structure
|
Common Name | Meprophendiol | ||
|---|---|---|---|---|
| CAS Number | 1087-06-5 | Molecular Weight | 254.27900 | |
| Density | 1.188g/cm3 | Boiling Point | 449.3ºC at 760 mmHg | |
| Molecular Formula | C13H18O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.9ºC | |
| Name | 1-[4-(2,3-Dihydroxypropoxy)-3-methoxyphenyl]-1-propanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.188g/cm3 |
|---|---|
| Boiling Point | 449.3ºC at 760 mmHg |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.27900 |
| Flash Point | 169.9ºC |
| Exact Mass | 254.11500 |
| PSA | 75.99000 |
| LogP | 1.01990 |
| Vapour Pressure | 7.36E-09mmHg at 25°C |
| Index of Refraction | 1.534 |
| InChIKey | SUTGJZFFEVGULT-UHFFFAOYSA-N |
| SMILES | CCC(=O)c1ccc(OCC(O)CO)c(OC)c1 |
| HS Code | 2914509090 |
|---|
|
~%
Meprophendiol CAS#:1087-06-5 |
| Literature: Casadio; Pala; Crescenzi; Marazzi-Uberti; Fresia Arzneimittel-Forschung, 1966 , vol. 16, # 5 p. 592 - 596 |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Caswell No. 380AB |
| Pix Ultra |
| BAS 083W |
| mepiquat chloride |
| Meprophendiol |
| 1,1-DIMETHYLPIPERIDINIUM CHLORIDE |
| Piperidinium,1,1-dimethyl-,chloride |
| 3-(2-Methoxy-4-propionyl-phenoxy)-propan-1,2-diol |
| N,N-Dimethylpiperidinium chloride |
| Methylpiperidine hydrochloride |