2,5-bis(thiophen-2-ylmethylidene)cyclopentan-1-one structure
|
Common Name | 2,5-bis(thiophen-2-ylmethylidene)cyclopentan-1-one | ||
|---|---|---|---|---|
| CAS Number | 1087-07-6 | Molecular Weight | 272.38500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H12OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,5-bis(thiophen-2-ylmethylidene)cyclopentan-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H12OS2 |
|---|---|
| Molecular Weight | 272.38500 |
| Exact Mass | 272.03300 |
| PSA | 73.55000 |
| LogP | 4.63950 |
| InChIKey | KPFZCKDPBMGECB-UHFFFAOYSA-N |
| SMILES | O=C1C(=Cc2cccs2)CCC1=Cc1cccs1 |
| HS Code | 2934999090 |
|---|
|
~84%
2,5-bis(thiophe... CAS#:1087-07-6 |
| Literature: Cremlyn, Richard J.; Frearson, Martin J.; Graham, Stephen Phosphorus, Sulfur and Silicon and the Related Elements, 1995 , vol. 107, # 1-4 p. 205 - 218 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,5-bis-[2]thienylmethylene-cyclopentanone |
| 2,5-di(2-thienylmethylidene)cyclopentan-1-one |
| Cyclopentanone,2,5-bis(2-thienylmethylene) |
| 2,5-di(2-thienylidene)cyclopentanone |
| 2,5-Bis-[2]thienylmethylen-cyclopentanon |
| 2,5-Bis-<2>thenyliden-cyclopentanon |