Teludipine hydrochloride structure
|
Common Name | Teludipine hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 108700-03-4 | Molecular Weight | 535.07200 | |
| Density | N/A | Boiling Point | 584.7ºC at 760mmHg | |
| Molecular Formula | C28H39ClN2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 307.4ºC | |
Use of Teludipine hydrochlorideTeludipine is a lipophilic calcium channel blocker. |
| Name | diethyl 2-[(dimethylamino)methyl]-6-methyl-4-[2-[(E)-3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enyl]phenyl]-1,4-dihydropyridine-3,5-dicarboxylate,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | Teludipine is a lipophilic calcium channel blocker. |
|---|---|
| Related Catalog | |
| Target |
Calcium channel[1] |
| In Vitro | Teludipine is a lipophilic calcium channel blocker. Telupidine is a new dihydropyridine derivative on cell lines displaying the multidrug resistant phenotype[1]. |
| References |
| Boiling Point | 584.7ºC at 760mmHg |
|---|---|
| Molecular Formula | C28H39ClN2O6 |
| Molecular Weight | 535.07200 |
| Flash Point | 307.4ºC |
| Exact Mass | 534.25000 |
| PSA | 94.17000 |
| LogP | 5.07500 |
| Vapour Pressure | 1.17E-13mmHg at 25°C |
| InChIKey | VMZCXIGDNRMWGI-GEEYTBSJSA-N |
| SMILES | CCOC(=O)C1=C(C)NC(CN(C)C)=C(C(=O)OCC)C1c1ccccc1C=CC(=O)OC(C)(C)C.Cl |
| Teludipine HCl |
| Teludipine Hydrochloride |
| Teludipine |
| UNII-7P6B96QLKN |
| Teludipine hydrochloride (USAN) |
| Taludipine HCl |