menthyl methyl lactate structure
|
Common Name | menthyl methyl lactate | ||
|---|---|---|---|---|
| CAS Number | 108766-16-1 | Molecular Weight | 242.35400 | |
| Density | 0.99g/cm3 | Boiling Point | 339.766ºC at 760 mmHg | |
| Molecular Formula | C14H26O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 132.555ºC | |
| Name | (5-methyl-2-propan-2-ylcyclohexyl) 3-hydroxybutanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.99g/cm3 |
|---|---|
| Boiling Point | 339.766ºC at 760 mmHg |
| Molecular Formula | C14H26O3 |
| Molecular Weight | 242.35400 |
| Flash Point | 132.555ºC |
| Exact Mass | 242.18800 |
| PSA | 46.53000 |
| LogP | 2.76130 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.469 |
| InChIKey | XSJPRWBZLUYOOI-UHFFFAOYSA-N |
| SMILES | CC(O)CC(=O)OC1CC(C)CCC1C(C)C |
| HS Code | 2918199090 |
|---|
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| menthyl 3-hydroxybutyrate |
| 3-hydroxy-butyric acid menthyl ester |
| 3-Hydroxy-buttersaeure-menthylester |
| Butanoic acid,3-hydroxy-,5-methyl-2-(1-methylethyl)cyclohexyl ester |
| menthyl 3-hydroxybutanate |
| 1-menthyl-3-hydroxybutyrate |