N-(4-amino-2-methoxyphenyl)-2,2-dimethylpropanamide structure
|
Common Name | N-(4-amino-2-methoxyphenyl)-2,2-dimethylpropanamide | ||
|---|---|---|---|---|
| CAS Number | 108792-09-2 | Molecular Weight | 222.28400 | |
| Density | 1.12g/cm3 | Boiling Point | 315.9ºC at 760 mmHg | |
| Molecular Formula | C12H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 144.9ºC | |
| Name | N-(4-amino-2-methoxyphenyl)-2,2-dimethylpropanamide |
|---|
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 315.9ºC at 760 mmHg |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.28400 |
| Flash Point | 144.9ºC |
| Exact Mass | 222.13700 |
| PSA | 64.35000 |
| LogP | 2.91620 |
| Vapour Pressure | 0.000424mmHg at 25°C |
| Index of Refraction | 1.572 |
| InChIKey | HLSNWZDYAAXRDK-UHFFFAOYSA-N |
| SMILES | COc1cc(N)ccc1NC(=O)C(C)(C)C |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |