2-{1H,2H,3H,4H,5H-pyrido[4,3-b]indole-2-carbonyl}pyridine
Modify Date: 2026-07-08 18:50:41
![2-{1H,2H,3H,4H,5H-pyrido[4,3-b]indole-2-carbonyl}pyridine Structure](https://www.chemsrc.com/extcaspic/443/1088198-41-7.png)
2-{1H,2H,3H,4H,5H-pyrido[4,3-b]indole-2-carbonyl}pyridine structure
|
Common Name | 2-{1H,2H,3H,4H,5H-pyrido[4,3-b]indole-2-carbonyl}pyridine | ||
|---|---|---|---|---|
| CAS Number | 1088198-41-7 | Molecular Weight | 277.32 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H15N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-{1H,2H,3H,4H,5H-pyrido[4,3-b]indole-2-carbonyl}pyridine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H15N3O |
|---|---|
| Molecular Weight | 277.32 |
| InChIKey | CEVDXBXXEDEDBR-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccn1)N1CCc2[nH]c3ccccc3c2C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-{1H,2H,3H,4H,5H-pyrido[4,3-b]indole-2-carbonyl}pyridine? |
| A: InChIKey of 2-{1H,2H,3H,4H,5H-pyrido[4,3-b]indole-2-carbonyl}pyridine is CEVDXBXXEDEDBR-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2-{1H,2H,3H,4H,5H-pyrido[4,3-b]indole-2-carbonyl}pyridine? |
| A: CAS number of 2-{1H,2H,3H,4H,5H-pyrido[4,3-b]indole-2-carbonyl}pyridine is 1088198-41-7. |
| Q: What is the Chinese name of 1088198-41-7? |
| A: Chinese name of 1088198-41-7 is 1088198-41-7. |
| Q: What is the molecular weight of 2-{1H,2H,3H,4H,5H-pyrido[4,3-b]indole-2-carbonyl}pyridine? |
| A: Molecular weight of 2-{1H,2H,3H,4H,5H-pyrido[4,3-b]indole-2-carbonyl}pyridine is 277.32. |
| Q: What is the molecular formula of 2-{1H,2H,3H,4H,5H-pyrido[4,3-b]indole-2-carbonyl}pyridine? |
| A: Molecular formula of 2-{1H,2H,3H,4H,5H-pyrido[4,3-b]indole-2-carbonyl}pyridine is C17H15N3O. |
| Q: What is the SMILES notation of 2-{1H,2H,3H,4H,5H-pyrido[4,3-b]indole-2-carbonyl}pyridine? |
| A: SMILES notation of 2-{1H,2H,3H,4H,5H-pyrido[4,3-b]indole-2-carbonyl}pyridine is O=C(c1ccccn1)N1CCc2[nH]c3ccccc3c2C1. |
| Q: What is the English name of 2-{1H,2H,3H,4H,5H-pyrido[4,3-b]indole-2-carbonyl}pyridine? |
| A: The English name of 2-{1H,2H,3H,4H,5H-pyrido[4,3-b]indole-2-carbonyl}pyridine is 2-{1H,2H,3H,4H,5H-pyrido[4,3-b]indole-2-carbonyl}pyridine. |