Z-L-Dbu(Boc)-OH structure
|
Common Name | Z-L-Dbu(Boc)-OH | ||
|---|---|---|---|---|
| CAS Number | 108919-51-3 | Molecular Weight | 352.38200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H24N2O6 | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Name | (3R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(phenylmethoxycarbonylamino)butanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H24N2O6 |
|---|---|
| Molecular Weight | 352.38200 |
| Exact Mass | 352.16300 |
| PSA | 113.96000 |
| LogP | 3.06260 |
| InChIKey | KUMMZCONPFBQTC-CYBMUJFWSA-N |
| SMILES | CC(C)(C)OC(=O)NCC(CC(=O)O)NC(=O)OCc1ccccc1 |
| Storage condition | 2-8°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Nbeta-Z-Ngamma-Boc-L-3,4-diaminobutyric acid |
| Ngamma-Boc-Nbeta-Z-L-3,4-diaminobutyric acid |