Suc-Ala-Ala-Pro-Lys-pNA structure
|
Common Name | Suc-Ala-Ala-Pro-Lys-pNA | ||
|---|---|---|---|---|
| CAS Number | 108929-39-1 | Molecular Weight | 605.64 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H39N7O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Suc-Ala-Ala-Pro-Lys-pNASuc-AAPK-pNA is a chromogenic substrate for the determination of serine/threonine kinase activity and enzyme kinetic parameters[1]. |
| Name | suc-ala-ala-pro-lys-pna |
|---|---|
| Synonym | More Synonyms |
| Description | Suc-AAPK-pNA is a chromogenic substrate for the determination of serine/threonine kinase activity and enzyme kinetic parameters[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C27H39N7O9 |
|---|---|
| Molecular Weight | 605.64 |
| Exact Mass | 605.28100 |
| PSA | 245.85000 |
| LogP | 2.41940 |
| InChIKey | SSKJMHLJNHUFHI-USNOLKROSA-N |
| SMILES | CC(NC(=O)CCC(=O)O)C(=O)NC(C)C(=O)N1CCCC1C(=O)NC(CCCCN)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| substance P5-11 |
| Suc-AAPK-pNA |
| L-Gln-L-Gln-L-Phe-L-Phe-Gly-L-Leu-L-Met-NH2 |
| Gln-Gln-Phe-Phe-Gly-Leu-Met-NH2 |
| H-GLN-GLN-PHE-PHE-GLY-LEU-MET-NH2 |
| HEPTA-SUBSTANCE P |
| substance P fragment 5-11 |