N-({4-[(diethylamino)methyl]phenyl}methyl)-2-(methylsulfanyl)pyridine-3-carboxamide
Modify Date: 2025-11-08 13:20:51
![N-({4-[(diethylamino)methyl]phenyl}methyl)-2-(methylsulfanyl)pyridine-3-carboxamide Structure](https://www.chemsrc.com/extcaspic/256/1089572-63-3.png)
N-({4-[(diethylamino)methyl]phenyl}methyl)-2-(methylsulfanyl)pyridine-3-carboxamide structure
|
Common Name | N-({4-[(diethylamino)methyl]phenyl}methyl)-2-(methylsulfanyl)pyridine-3-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 1089572-63-3 | Molecular Weight | 343.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H25N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-({4-[(diethylamino)methyl]phenyl}methyl)-2-(methylsulfanyl)pyridine-3-carboxamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H25N3OS |
|---|---|
| Molecular Weight | 343.5 |
| InChIKey | SOAHNVHBURIQNN-UHFFFAOYSA-N |
| SMILES | CCN(CC)Cc1ccc(CNC(=O)c2cccnc2SC)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of N-({4-[(diethylamino)methyl]phenyl}methyl)-2-(methylsulfanyl)pyridine-3-carboxamide? |
| A: InChIKey of N-({4-[(diethylamino)methyl]phenyl}methyl)-2-(methylsulfanyl)pyridine-3-carboxamide is SOAHNVHBURIQNN-UHFFFAOYSA-N. |
| Q: What is the English name of N-({4-[(diethylamino)methyl]phenyl}methyl)-2-(methylsulfanyl)pyridine-3-carboxamide? |
| A: The English name of N-({4-[(diethylamino)methyl]phenyl}methyl)-2-(methylsulfanyl)pyridine-3-carboxamide is N-({4-[(diethylamino)methyl]phenyl}methyl)-2-(methylsulfanyl)pyridine-3-carboxamide. |
| Q: What is the SMILES notation of N-({4-[(diethylamino)methyl]phenyl}methyl)-2-(methylsulfanyl)pyridine-3-carboxamide? |
| A: SMILES notation of N-({4-[(diethylamino)methyl]phenyl}methyl)-2-(methylsulfanyl)pyridine-3-carboxamide is CCN(CC)Cc1ccc(CNC(=O)c2cccnc2SC)cc1. |
| Q: What is the molecular formula of N-({4-[(diethylamino)methyl]phenyl}methyl)-2-(methylsulfanyl)pyridine-3-carboxamide? |
| A: Molecular formula of N-({4-[(diethylamino)methyl]phenyl}methyl)-2-(methylsulfanyl)pyridine-3-carboxamide is C19H25N3OS. |
| Q: What is the molecular weight of N-({4-[(diethylamino)methyl]phenyl}methyl)-2-(methylsulfanyl)pyridine-3-carboxamide? |
| A: Molecular weight of N-({4-[(diethylamino)methyl]phenyl}methyl)-2-(methylsulfanyl)pyridine-3-carboxamide is 343.5. |
| Q: What is the CAS number of N-({4-[(diethylamino)methyl]phenyl}methyl)-2-(methylsulfanyl)pyridine-3-carboxamide? |
| A: CAS number of N-({4-[(diethylamino)methyl]phenyl}methyl)-2-(methylsulfanyl)pyridine-3-carboxamide is 1089572-63-3. |
| Q: What is the Chinese name of 1089572-63-3? |
| A: Chinese name of 1089572-63-3 is 1089572-63-3. |