1-Benzopyrylium,5,7-dihydroxy-2-(4-methoxyphenyl)-, chloride (9CI) structure
|
Common Name | 1-Benzopyrylium,5,7-dihydroxy-2-(4-methoxyphenyl)-, chloride (9CI) | ||
|---|---|---|---|---|
| CAS Number | 1090-74-0 | Molecular Weight | 270.28000 | |
| Density | 1.314g/cm3 | Boiling Point | 520.9ºC at 760mmHg | |
| Molecular Formula | C16H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 268.8ºC | |
| Name | 2-(4-methoxyphenyl)-2H-chromene-5,7-diol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.314g/cm3 |
|---|---|
| Boiling Point | 520.9ºC at 760mmHg |
| Molecular Formula | C16H14O4 |
| Molecular Weight | 270.28000 |
| Flash Point | 268.8ºC |
| Exact Mass | 270.08900 |
| PSA | 58.92000 |
| LogP | 3.25330 |
| Vapour Pressure | 1.8E-11mmHg at 25°C |
| Index of Refraction | 1.644 |
| InChIKey | LEAGNOBTDPUZGZ-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2ccc3c(O)cc(O)cc3[o+]2)cc1.[Cl-] |
| HS Code | 2909499000 |
|---|
| HS Code | 2909499000 |
|---|---|
| Summary | 2909499000. ether-alcohols and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
| Acacetinidinchlorid |