3-(4-methylphenyl)sulfonyl-3-azabicyclo[2.2.1]hept-5-en-2-one structure
|
Common Name | 3-(4-methylphenyl)sulfonyl-3-azabicyclo[2.2.1]hept-5-en-2-one | ||
|---|---|---|---|---|
| CAS Number | 109000-07-9 | Molecular Weight | 263.31200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H13NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(4-methylphenyl)sulfonyl-3-azabicyclo[2.2.1]hept-5-en-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H13NO3S |
|---|---|
| Molecular Weight | 263.31200 |
| Exact Mass | 263.06200 |
| PSA | 62.83000 |
| LogP | 2.48930 |
| InChIKey | LXJWTEPJMYAFKP-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)N2C(=O)C3C=CC2C3)cc1 |
|
~58%
3-(4-methylphen... CAS#:109000-07-9 |
| Literature: Jung; Rhee Journal of Organic Chemistry, 1994 , vol. 59, # 17 p. 4719 - 4720 |
|
~%
3-(4-methylphen... CAS#:109000-07-9 |
| Literature: Jung; Rhee Journal of Organic Chemistry, 1994 , vol. 59, # 17 p. 4719 - 4720 |
| Precursor 3 | |
|---|---|
| DownStream 1 | |
| 2-Azabicyclo[2.2.1]hept-5-en-3-one,2-[(4-methylphenyl)sulfonyl] |
| 2-(p-tolylsulfonyl)-2-azabicyclo<2.2.1>hept-5-en-3-one |